benzyl (1-hydroxy-3-phenylpropan-2-yl)carbamate
N-Benzyloxycarbonyl-L-phenylalaninol
CAS: 6372-14-1
Molecular Formula: C17H19NO3
benzyl (1-hydroxy-3-phenylpropan-2-yl)carbamate - Names and Identifiers
| Name | N-Benzyloxycarbonyl-L-phenylalaninol |
| Synonyms | Z-PHE-OL Z-PHENYLALANINOL CBZ-PHENYLALANINOL Z-L-PHENYLALANINOL CBZ-L-PHENYLALANINOL (S)-Cbz-Phenylalaninol N-CBZ-L-PHENYLALANINOL N-A-CBZ-L-PHENYLALANINOL N-carbobenzyloxyphenylalaninol N-Benzyloxycarbonyl-L-phenylalaninol benzyl (1-hydroxy-3-phenylpropan-2-yl)carbamate benzyl [(2S)-1-hydroxy-3-phenylpropan-2-yl]carbamate |
| CAS | 6372-14-1 |
| EINECS | 1533716-785-6 |
| InChI | InChI=1/C17H19NO3/c19-12-16(11-14-7-3-1-4-8-14)18-17(20)21-13-15-9-5-2-6-10-15/h1-10,16,19H,11-13H2,(H,18,20)/t16-/m0/s1 |
benzyl (1-hydroxy-3-phenylpropan-2-yl)carbamate - Physico-chemical Properties
| Molecular Formula | C17H19NO3 |
| Molar Mass | 285.34 |
| Density | 1.0864 (rough estimate) |
| Melting Point | 92-95°C |
| Boling Point | 427.77°C (rough estimate) |
| Specific Rotation(α) | -45 º (c=2, MeOH) |
| Flash Point | 249.6°C |
| Water Solubility | insoluble |
| Vapor Presure | 2.23E-10mmHg at 25°C |
| Appearance | powder to crystal |
| Color | White to Almost white |
| BRN | 2816420 |
| pKa | 11.86±0.46(Predicted) |
| Storage Condition | Sealed in dry,2-8°C |
| Refractive Index | -42 ° (C=2, MeOH) |
benzyl (1-hydroxy-3-phenylpropan-2-yl)carbamate - Risk and Safety
| Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| FLUKA BRAND F CODES | 10-23 |
| HS Code | 29051990 |
benzyl (1-hydroxy-3-phenylpropan-2-yl)carbamate - Introduction
N-Benzyloxycarbonyl-L-phenylalaninol(N-Benzyloxycarbonyl-L-phenylalaninol) is an organic compound whose chemical formula is C17H17NO3. The compound has the following properties:
1. Appearance: white crystalline powder or crystal.
2. melting point: about 115-120 degrees Celsius.
3. Solubility: Soluble in alcohols and ketones, slightly soluble in ether and chloroform.
N-Benzyloxycarbonyl-L-phenylalaninol have some applications in the chemical and biological fields, such:
1. Synthesis intermediate: It can be used as an intermediate for the preparation of other organic compounds, such as drugs, heterocyclic compounds and chiral reagents.
2. Drug research: The compound is used to synthesize specific drugs or drug candidates, such as protease inhibitors and anti-tumor drugs.
One way to prepare N-Benzyloxycarbonyl-L-phenylalaninol is to synthesize them by the following reaction:
1. L-phenylalanine is reacted with benzyl alcohol to form N-benzyloxycarbonyl-L-phenylalanine benzyl ester.
2. reducing N-benzyloxycarbonyl-L-phenylalanine benzyl ester to N-Benzyloxycarbonyl-L-phenylalaninol.
From preparation to use, you need to pay attention to the following safety information:
1. Avoid contact with skin and eyes to avoid irritation or allergic reactions.
2. during use, good laboratory practices should be adopted, such as wearing protective gloves, goggles and laboratory coats.
3. storage should be sealed, away from heat and oxidant, in order to avoid the risk of fire or explosion.
4. Do not mix the compound with a strong oxidant to avoid dangerous reactions.
5. When using or handling this compound, follow the guidelines for the safe use of the relevant chemicals and properly dispose of waste.
1. Appearance: white crystalline powder or crystal.
2. melting point: about 115-120 degrees Celsius.
3. Solubility: Soluble in alcohols and ketones, slightly soluble in ether and chloroform.
N-Benzyloxycarbonyl-L-phenylalaninol have some applications in the chemical and biological fields, such:
1. Synthesis intermediate: It can be used as an intermediate for the preparation of other organic compounds, such as drugs, heterocyclic compounds and chiral reagents.
2. Drug research: The compound is used to synthesize specific drugs or drug candidates, such as protease inhibitors and anti-tumor drugs.
One way to prepare N-Benzyloxycarbonyl-L-phenylalaninol is to synthesize them by the following reaction:
1. L-phenylalanine is reacted with benzyl alcohol to form N-benzyloxycarbonyl-L-phenylalanine benzyl ester.
2. reducing N-benzyloxycarbonyl-L-phenylalanine benzyl ester to N-Benzyloxycarbonyl-L-phenylalaninol.
From preparation to use, you need to pay attention to the following safety information:
1. Avoid contact with skin and eyes to avoid irritation or allergic reactions.
2. during use, good laboratory practices should be adopted, such as wearing protective gloves, goggles and laboratory coats.
3. storage should be sealed, away from heat and oxidant, in order to avoid the risk of fire or explosion.
4. Do not mix the compound with a strong oxidant to avoid dangerous reactions.
5. When using or handling this compound, follow the guidelines for the safe use of the relevant chemicals and properly dispose of waste.
Last Update：2024-04-09 21:21:28
